C64H80N2Si4 — CID 58383868
3,8-dicyclohexyl-1-N,1-N,6-N,6-N-tetrakis(4-trimethylsilylphenyl)pyrene-1,6-diamine (PubChem CID 58383868) has the molecular formula C64H80N2Si4 and a molecular weight of 989.70 g/mol. Its IUPAC name is 3,8-dicyclohexyl-1-N,1-N,6-N,6-N-tetrakis(4-trimethylsilylphenyl)pyrene-1,6-diamine.
| Compound Name | 3,8-dicyclohexyl-1-N,1-N,6-N,6-N-tetrakis(4-trimethylsilylphenyl)pyrene-1,6-diamine |
|---|---|
| PubChem CID | 58383868 |
| Molecular Formula | C64H80N2Si4 |
| Molecular Weight | 989.70 g/mol |
| Exact Mass | 988.54 |
| IUPAC Name | 3,8-dicyclohexyl-1-N,1-N,6-N,6-N-tetrakis(4-trimethylsilylphenyl)pyrene-1,6-diamine |
| SMILES | C[Si](C)(C)c1ccc(N(c2ccc([Si](C)(C)C)cc2)c2cc(C3CCCCC3)c3ccc4c(N(c5ccc([Si](C)(C)C)cc5)c5ccc([Si](C)(C)C)cc5)cc(C5CCCCC5)c5ccc2c3c54)cc1 |
| InChI | InChI=1S/C64H80N2Si4/c1-67(2,3)51-31-23-47(24-32-51)65(48-25-33-52(34-26-48)68(4,5)6)61-43-59(45-19-15-13-16-20-45)55-40-42-58-62(44-60(46-21-17-14-18-22-46)56-39-41-57(61)63(55)64(56)58)66(49-27-35-53(36-28-49)69(7,8)9)50-29-37-54(38-30-50)70(10,11)12/h23-46H,13-22H2,1-12H3 |
| InChIKey | BCACBGAQLVCODA-UHFFFAOYSA-N |
| XLogP | 17.80 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 989.70 |
| LogP ≤ 5 | 17.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|