C18H12F10 — CID 58383937
1,2,3,4,5-pentafluoro-6-[4-(2,3,4,5,6-pentafluorophenyl)hexan-2-yl]benzene (PubChem CID 58383937) has the molecular formula C18H12F10 and a molecular weight of 418.27 g/mol. Its IUPAC name is 1,2,3,4,5-pentafluoro-6-[4-(2,3,4,5,6-pentafluorophenyl)hexan-2-yl]benzene.
| Compound Name | 1,2,3,4,5-pentafluoro-6-[4-(2,3,4,5,6-pentafluorophenyl)hexan-2-yl]benzene |
|---|---|
| PubChem CID | 58383937 |
| Molecular Formula | C18H12F10 |
| Molecular Weight | 418.27 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | 1,2,3,4,5-pentafluoro-6-[4-(2,3,4,5,6-pentafluorophenyl)hexan-2-yl]benzene |
| SMILES | CCC(CC(C)c1c(F)c(F)c(F)c(F)c1F)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C18H12F10/c1-3-6(8-11(21)15(25)18(28)16(26)12(8)22)4-5(2)7-9(19)13(23)17(27)14(24)10(7)20/h5-6H,3-4H2,1-2H3 |
| InChIKey | DVXIGRPKKJJZMG-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.27 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|