C36H38IrN2O2-2 — CID 58384091
6-(4-ethylphenyl)hexane-2,4-diol;iridium;bis(2-phenylpyridine) (PubChem CID 58384091) has the molecular formula C36H38IrN2O2-2 and a molecular weight of 722.93 g/mol. Its IUPAC name is 6-(4-ethylphenyl)hexane-2,4-diol;iridium;bis(2-phenylpyridine).
| Compound Name | 6-(4-ethylphenyl)hexane-2,4-diol;iridium;bis(2-phenylpyridine) |
|---|---|
| PubChem CID | 58384091 |
| Molecular Formula | C36H38IrN2O2-2 |
| Molecular Weight | 722.93 g/mol |
| Exact Mass | 723.26 |
| IUPAC Name | 6-(4-ethylphenyl)hexane-2,4-diol;iridium;bis(2-phenylpyridine) |
| SMILES | CCc1ccc(CCC(O)CC(C)O)cc1.[Ir].[c-]1ccccc1-c1ccccn1.[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C14H22O2.2C11H8N.Ir/c1-3-12-4-6-13(7-5-12)8-9-14(16)10-11(2)15;2*1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h4-7,11,14-16H,3,8-10H2,1-2H3;2*1-6,8-9H;/q;2*-1; |
| InChIKey | KMVVVEWQTZRICP-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.93 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|