C17H30O — CID 58384236
(2E)-2-[(4aS,7S,8aS)-7-ethyl-8,8-dimethyl-1,3,4,4a,5,6,7,8a-octahydronaphthalen-2-ylidene]propan-1-ol (PubChem CID 58384236) has the molecular formula C17H30O and a molecular weight of 250.43 g/mol. Its IUPAC name is (2E)-2-[(4aS,7S,8aS)-7-ethyl-8,8-dimethyl-1,3,4,4a,5,6,7,8a-octahydronaphthalen-2-ylidene]propan-1-ol.
| Compound Name | (2E)-2-[(4aS,7S,8aS)-7-ethyl-8,8-dimethyl-1,3,4,4a,5,6,7,8a-octahydronaphthalen-2-ylidene]propan-1-ol |
|---|---|
| PubChem CID | 58384236 |
| Molecular Formula | C17H30O |
| Molecular Weight | 250.43 g/mol |
| Exact Mass | 250.23 |
| IUPAC Name | (2E)-2-[(4aS,7S,8aS)-7-ethyl-8,8-dimethyl-1,3,4,4a,5,6,7,8a-octahydronaphthalen-2-ylidene]propan-1-ol |
| SMILES | CC[C@H]1CC[C@H]2CC/C(=C(/C)CO)C[C@@H]2C1(C)C |
| InChI | InChI=1S/C17H30O/c1-5-15-9-8-13-6-7-14(12(2)11-18)10-16(13)17(15,3)4/h13,15-16,18H,5-11H2,1-4H3/b14-12+/t13-,15+,16+/m1/s1 |
| InChIKey | LLDVHHOTXPJBRW-LBJCOTLMSA-N |
| XLogP | 4.56 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.43 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|