C26H27FN4O2 — CID 58384930
2,5,8-trideuterio-4-(4-fluoro-3-methylanilino)-6-[(E)-5-[methyl(trideuteriomethyl)amino]-2-oxopent-3-enyl]-7-(1,1,2,2,2-pentadeuterioethoxy)quinoline-3-carbonitrile (PubChem CID 58384930) has the molecular formula C26H27FN4O2 and a molecular weight of 457.59 g/mol. Its IUPAC name is 2,5,8-trideuterio-4-(4-fluoro-3-methylanilino)-6-[(E)-5-[methyl(trideuteriomethyl)amino]-2-oxopent-3-enyl]-7-(1,1,2,2,2-pentadeuterioethoxy)quinoline-3-carbonitrile.
| Compound Name | 2,5,8-trideuterio-4-(4-fluoro-3-methylanilino)-6-[(E)-5-[methyl(trideuteriomethyl)amino]-2-oxopent-3-enyl]-7-(1,1,2,2,2-pentadeuterioethoxy)quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 58384930 |
| Molecular Formula | C26H27FN4O2 |
| Molecular Weight | 457.59 g/mol |
| Exact Mass | 457.28 |
| IUPAC Name | 2,5,8-trideuterio-4-(4-fluoro-3-methylanilino)-6-[(E)-5-[methyl(trideuteriomethyl)amino]-2-oxopent-3-enyl]-7-(1,1,2,2,2-pentadeuterioethoxy)quinoline-3-carbonitrile |
| SMILES | [2H]c1nc2c([2H])c(OC([2H])([2H])C([2H])([2H])[2H])c(CC(=O)/C=C/CN(C)C([2H])([2H])[2H])c([2H])c2c(Nc2ccc(F)c(C)c2)c1C#N |
| InChI | InChI=1S/C26H27FN4O2/c1-5-33-25-14-24-22(13-18(25)12-21(32)7-6-10-31(3)4)26(19(15-28)16-29-24)30-20-8-9-23(27)17(2)11-20/h6-9,11,13-14,16H,5,10,12H2,1-4H3,(H,29,30)/b7-6+/i1D3,3D3,5D2,13D,14D,16D |
| InChIKey | JAZRKVDDBCWOAY-AXOOPUOWSA-N |
| XLogP | 4.93 |
| TPSA | 78.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.59 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|