About 4-(2-aminoethyl)-2,6-dimethylheptan-3-one
4-(2-aminoethyl)-2,6-dimethylheptan-3-one (PubChem CID 58385262) has the molecular formula C11H23NO
and a molecular weight of 185.31 g/mol. Its IUPAC name is 4-(2-aminoethyl)-2,6-dimethylheptan-3-one.
Molecular Properties
| Compound Name | 4-(2-aminoethyl)-2,6-dimethylheptan-3-one |
| PubChem CID | 58385262 |
| Molecular Formula | C11H23NO |
| Molecular Weight | 185.31 g/mol |
| Exact Mass | 185.18 |
| IUPAC Name | 4-(2-aminoethyl)-2,6-dimethylheptan-3-one |
| SMILES | CC(C)CC(CCN)C(=O)C(C)C |
| InChI | InChI=1S/C11H23NO/c1-8(2)7-10(5-6-12)11(13)9(3)4/h8-10H,5-7,12H2,1-4H3 |
| InChIKey | BLPFWVOTOJHQDW-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.31 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(2-aminoethyl)-2,6-dimethylheptan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-aminoethyl)-2,6-dimethylheptan-3-one?
The IUPAC name of 4-(2-aminoethyl)-2,6-dimethylheptan-3-one (CID 58385262) is 4-(2-aminoethyl)-2,6-dimethylheptan-3-one.
What is the SMILES notation for 4-(2-aminoethyl)-2,6-dimethylheptan-3-one?
The canonical SMILES for 4-(2-aminoethyl)-2,6-dimethylheptan-3-one is CC(C)CC(CCN)C(=O)C(C)C.
What is the InChIKey of 4-(2-aminoethyl)-2,6-dimethylheptan-3-one?
The InChIKey is BLPFWVOTOJHQDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NO/c1-8(2)7-10(5-6-12)11(13)9(3)4/h8-10H,5-7,12H2,1-4H3.
What are the key properties of 4-(2-aminoethyl)-2,6-dimethylheptan-3-one?
4-(2-aminoethyl)-2,6-dimethylheptan-3-one has a molecular weight of 185.31 g/mol, XLogP of 2.22, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-aminoethyl)-2,6-dimethylheptan-3-one is sourced from PubChem (CID 58385262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).