C46H87NO2 — CID 58385513
N,N,4-trimethyl-6,7-bis[(9Z,12Z)-octadeca-9,12-dienoxy]heptan-1-amine (PubChem CID 58385513) has the molecular formula C46H87NO2 and a molecular weight of 686.21 g/mol. Its IUPAC name is N,N,4-trimethyl-6,7-bis[(9Z,12Z)-octadeca-9,12-dienoxy]heptan-1-amine.
| Compound Name | N,N,4-trimethyl-6,7-bis[(9Z,12Z)-octadeca-9,12-dienoxy]heptan-1-amine |
|---|---|
| PubChem CID | 58385513 |
| Molecular Formula | C46H87NO2 |
| Molecular Weight | 686.21 g/mol |
| Exact Mass | 685.67 |
| IUPAC Name | N,N,4-trimethyl-6,7-bis[(9Z,12Z)-octadeca-9,12-dienoxy]heptan-1-amine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCOCC(CC(C)CCCN(C)C)OCCCCCCCC/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C46H87NO2/c1-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-41-48-44-46(43-45(3)39-38-40-47(4)5)49-42-37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-2/h14-17,20-23,45-46H,6-13,18-19,24-44H2,1-5H3/b16-14-,17-15-,22-20-,23-21- |
| InChIKey | WOMPNUMHMOHBNO-ZPPAUJSGSA-N |
| XLogP | 14.38 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.21 |
| LogP ≤ 5 | 14.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|