C31H40F6N2O2 — CID 58385638
6-[1,1,1,3,3,3-hexafluoro-2-(3-hexyl-2,4-dihydro-1,3-benzoxazin-6-yl)propan-2-yl]-3-hexyl-2,4-dihydro-1,3-benzoxazine (PubChem CID 58385638) has the molecular formula C31H40F6N2O2 and a molecular weight of 586.66 g/mol. Its IUPAC name is 6-[1,1,1,3,3,3-hexafluoro-2-(3-hexyl-2,4-dihydro-1,3-benzoxazin-6-yl)propan-2-yl]-3-hexyl-2,4-dihydro-1,3-benzoxazine.
| Compound Name | 6-[1,1,1,3,3,3-hexafluoro-2-(3-hexyl-2,4-dihydro-1,3-benzoxazin-6-yl)propan-2-yl]-3-hexyl-2,4-dihydro-1,3-benzoxazine |
|---|---|
| PubChem CID | 58385638 |
| Molecular Formula | C31H40F6N2O2 |
| Molecular Weight | 586.66 g/mol |
| Exact Mass | 586.30 |
| IUPAC Name | 6-[1,1,1,3,3,3-hexafluoro-2-(3-hexyl-2,4-dihydro-1,3-benzoxazin-6-yl)propan-2-yl]-3-hexyl-2,4-dihydro-1,3-benzoxazine |
| SMILES | CCCCCCN1COc2ccc(C(c3ccc4c(c3)CN(CCCCCC)CO4)(C(F)(F)F)C(F)(F)F)cc2C1 |
| InChI | InChI=1S/C31H40F6N2O2/c1-3-5-7-9-15-38-19-23-17-25(11-13-27(23)40-21-38)29(30(32,33)34,31(35,36)37)26-12-14-28-24(18-26)20-39(22-41-28)16-10-8-6-4-2/h11-14,17-18H,3-10,15-16,19-22H2,1-2H3 |
| InChIKey | BYOSUBFXOYYZCZ-UHFFFAOYSA-N |
| XLogP | 8.56 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.66 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|