About 2,4-dimethylpentan-2-yl 2-methylpropanoate
2,4-dimethylpentan-2-yl 2-methylpropanoate (PubChem CID 58385667) has the molecular formula C11H22O2
and a molecular weight of 186.29 g/mol. Its IUPAC name is 2,4-dimethylpentan-2-yl 2-methylpropanoate.
Molecular Properties
| Compound Name | 2,4-dimethylpentan-2-yl 2-methylpropanoate |
| PubChem CID | 58385667 |
| Molecular Formula | C11H22O2 |
| Molecular Weight | 186.29 g/mol |
| Exact Mass | 186.16 |
| IUPAC Name | 2,4-dimethylpentan-2-yl 2-methylpropanoate |
| SMILES | CC(C)CC(C)(C)OC(=O)C(C)C |
| InChI | InChI=1S/C11H22O2/c1-8(2)7-11(5,6)13-10(12)9(3)4/h8-9H,7H2,1-6H3 |
| InChIKey | KSEYCSFGPPVUAO-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.29 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,4-dimethylpentan-2-yl 2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethylpentan-2-yl 2-methylpropanoate?
The IUPAC name of 2,4-dimethylpentan-2-yl 2-methylpropanoate (CID 58385667) is 2,4-dimethylpentan-2-yl 2-methylpropanoate.
What is the SMILES notation for 2,4-dimethylpentan-2-yl 2-methylpropanoate?
The canonical SMILES for 2,4-dimethylpentan-2-yl 2-methylpropanoate is CC(C)CC(C)(C)OC(=O)C(C)C.
What is the InChIKey of 2,4-dimethylpentan-2-yl 2-methylpropanoate?
The InChIKey is KSEYCSFGPPVUAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O2/c1-8(2)7-11(5,6)13-10(12)9(3)4/h8-9H,7H2,1-6H3.
What are the key properties of 2,4-dimethylpentan-2-yl 2-methylpropanoate?
2,4-dimethylpentan-2-yl 2-methylpropanoate has a molecular weight of 186.29 g/mol, XLogP of 3.01, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethylpentan-2-yl 2-methylpropanoate is sourced from PubChem (CID 58385667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).