C20H20F2N6O2 — CID 58386298
N-[5-[(2R)-2-(2,5-difluorophenyl)pyrrolidin-1-yl]pyrazolo[1,5-a]pyrimidin-3-yl]-N',N'-dimethyloxamide (PubChem CID 58386298) has the molecular formula C20H20F2N6O2 and a molecular weight of 414.42 g/mol. Its IUPAC name is N-[5-[(2R)-2-(2,5-difluorophenyl)pyrrolidin-1-yl]pyrazolo[1,5-a]pyrimidin-3-yl]-N',N'-dimethyloxamide.
| Compound Name | N-[5-[(2R)-2-(2,5-difluorophenyl)pyrrolidin-1-yl]pyrazolo[1,5-a]pyrimidin-3-yl]-N',N'-dimethyloxamide |
|---|---|
| PubChem CID | 58386298 |
| Molecular Formula | C20H20F2N6O2 |
| Molecular Weight | 414.42 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | N-[5-[(2R)-2-(2,5-difluorophenyl)pyrrolidin-1-yl]pyrazolo[1,5-a]pyrimidin-3-yl]-N',N'-dimethyloxamide |
| SMILES | CN(C)C(=O)C(=O)Nc1cnn2ccc(N3CCC[C@@H]3c3cc(F)ccc3F)nc12 |
| InChI | InChI=1S/C20H20F2N6O2/c1-26(2)20(30)19(29)24-15-11-23-28-9-7-17(25-18(15)28)27-8-3-4-16(27)13-10-12(21)5-6-14(13)22/h5-7,9-11,16H,3-4,8H2,1-2H3,(H,24,29)/t16-/m1/s1 |
| InChIKey | ASNCBWCDJMZVSE-MRXNPFEDSA-N |
| XLogP | 2.38 |
| TPSA | 82.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.42 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|