C19H18F2N6O2 — CID 58386327
N'-[5-[(2R)-2-(2,5-difluorophenyl)pyrrolidin-1-yl]pyrazolo[1,5-a]pyrimidin-3-yl]-N-methyloxamide (PubChem CID 58386327) has the molecular formula C19H18F2N6O2 and a molecular weight of 400.39 g/mol. Its IUPAC name is N'-[5-[(2R)-2-(2,5-difluorophenyl)pyrrolidin-1-yl]pyrazolo[1,5-a]pyrimidin-3-yl]-N-methyloxamide.
| Compound Name | N'-[5-[(2R)-2-(2,5-difluorophenyl)pyrrolidin-1-yl]pyrazolo[1,5-a]pyrimidin-3-yl]-N-methyloxamide |
|---|---|
| PubChem CID | 58386327 |
| Molecular Formula | C19H18F2N6O2 |
| Molecular Weight | 400.39 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | N'-[5-[(2R)-2-(2,5-difluorophenyl)pyrrolidin-1-yl]pyrazolo[1,5-a]pyrimidin-3-yl]-N-methyloxamide |
| SMILES | CNC(=O)C(=O)Nc1cnn2ccc(N3CCC[C@@H]3c3cc(F)ccc3F)nc12 |
| InChI | InChI=1S/C19H18F2N6O2/c1-22-18(28)19(29)24-14-10-23-27-8-6-16(25-17(14)27)26-7-2-3-15(26)12-9-11(20)4-5-13(12)21/h4-6,8-10,15H,2-3,7H2,1H3,(H,22,28)(H,24,29)/t15-/m1/s1 |
| InChIKey | NATYJNDZWKBODH-OAHLLOKOSA-N |
| XLogP | 2.03 |
| TPSA | 91.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.39 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|