About 5-fluoro-1,3,3-trimethyl-2H-indole
5-fluoro-1,3,3-trimethyl-2H-indole (PubChem CID 58386422) has the molecular formula C11H14FN
and a molecular weight of 179.24 g/mol. Its IUPAC name is 5-fluoro-1,3,3-trimethyl-2H-indole.
Molecular Properties
| Compound Name | 5-fluoro-1,3,3-trimethyl-2H-indole |
| PubChem CID | 58386422 |
| Molecular Formula | C11H14FN |
| Molecular Weight | 179.24 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | 5-fluoro-1,3,3-trimethyl-2H-indole |
| SMILES | CN1CC(C)(C)c2cc(F)ccc21 |
| InChI | InChI=1S/C11H14FN/c1-11(2)7-13(3)10-5-4-8(12)6-9(10)11/h4-6H,7H2,1-3H3 |
| InChIKey | SWUYYRGSJSQWEU-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.24 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-fluoro-1,3,3-trimethyl-2H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-1,3,3-trimethyl-2H-indole?
The IUPAC name of 5-fluoro-1,3,3-trimethyl-2H-indole (CID 58386422) is 5-fluoro-1,3,3-trimethyl-2H-indole.
What is the SMILES notation for 5-fluoro-1,3,3-trimethyl-2H-indole?
The canonical SMILES for 5-fluoro-1,3,3-trimethyl-2H-indole is CN1CC(C)(C)c2cc(F)ccc21.
What is the InChIKey of 5-fluoro-1,3,3-trimethyl-2H-indole?
The InChIKey is SWUYYRGSJSQWEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14FN/c1-11(2)7-13(3)10-5-4-8(12)6-9(10)11/h4-6H,7H2,1-3H3.
What are the key properties of 5-fluoro-1,3,3-trimethyl-2H-indole?
5-fluoro-1,3,3-trimethyl-2H-indole has a molecular weight of 179.24 g/mol, XLogP of 2.55, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-1,3,3-trimethyl-2H-indole is sourced from PubChem (CID 58386422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).