C10H11F2N — CID 58386577
5,6-difluoro-1,3-dimethyl-2,3-dihydroindole (PubChem CID 58386577) has the molecular formula C10H11F2N and a molecular weight of 183.20 g/mol. Its IUPAC name is 5,6-difluoro-1,3-dimethyl-2,3-dihydroindole.
| Compound Name | 5,6-difluoro-1,3-dimethyl-2,3-dihydroindole |
|---|---|
| PubChem CID | 58386577 |
| Molecular Formula | C10H11F2N |
| Molecular Weight | 183.20 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | 5,6-difluoro-1,3-dimethyl-2,3-dihydroindole |
| SMILES | CC1CN(C)c2cc(F)c(F)cc21 |
| InChI | InChI=1S/C10H11F2N/c1-6-5-13(2)10-4-9(12)8(11)3-7(6)10/h3-4,6H,5H2,1-2H3 |
| InChIKey | BTEJVJFCRYITKD-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.20 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |