About 1,5,7,7-tetramethyl-4,6-dihydropyrazolo[4,5-c]pyridine
1,5,7,7-tetramethyl-4,6-dihydropyrazolo[4,5-c]pyridine (PubChem CID 58386609) has the molecular formula C10H17N3
and a molecular weight of 179.27 g/mol. Its IUPAC name is 1,5,7,7-tetramethyl-4,6-dihydropyrazolo[4,5-c]pyridine.
Analyze 1,5,7,7-tetramethyl-4,6-dihydropyrazolo[4,5-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5,7,7-tetramethyl-4,6-dihydropyrazolo[4,5-c]pyridine?
The IUPAC name of 1,5,7,7-tetramethyl-4,6-dihydropyrazolo[4,5-c]pyridine (CID 58386609) is 1,5,7,7-tetramethyl-4,6-dihydropyrazolo[4,5-c]pyridine.
What is the SMILES notation for 1,5,7,7-tetramethyl-4,6-dihydropyrazolo[4,5-c]pyridine?
The canonical SMILES for 1,5,7,7-tetramethyl-4,6-dihydropyrazolo[4,5-c]pyridine is CN1Cc2cnn(C)c2C(C)(C)C1.
What is the InChIKey of 1,5,7,7-tetramethyl-4,6-dihydropyrazolo[4,5-c]pyridine?
The InChIKey is NKZUJLMHMJAKPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3/c1-10(2)7-12(3)6-8-5-11-13(4)9(8)10/h5H,6-7H2,1-4H3.
What are the key properties of 1,5,7,7-tetramethyl-4,6-dihydropyrazolo[4,5-c]pyridine?
1,5,7,7-tetramethyl-4,6-dihydropyrazolo[4,5-c]pyridine has a molecular weight of 179.27 g/mol, XLogP of 1.14, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5,7,7-tetramethyl-4,6-dihydropyrazolo[4,5-c]pyridine is sourced from PubChem (CID 58386609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).