C24H31N3O5S2 — CID 58386929
2-[2-(4,4-dimethylcyclohexen-1-yl)-4-(2-methyl-1,1,3,3-tetraoxo-1,3,2-dithiazinan-5-yl)phenyl]-1-(5-methyl-1H-imidazol-2-yl)ethanone (PubChem CID 58386929) has the molecular formula C24H31N3O5S2 and a molecular weight of 505.66 g/mol. Its IUPAC name is 2-[2-(4,4-dimethylcyclohexen-1-yl)-4-(2-methyl-1,1,3,3-tetraoxo-1,3,2-dithiazinan-5-yl)phenyl]-1-(5-methyl-1H-imidazol-2-yl)ethanone.
| Compound Name | 2-[2-(4,4-dimethylcyclohexen-1-yl)-4-(2-methyl-1,1,3,3-tetraoxo-1,3,2-dithiazinan-5-yl)phenyl]-1-(5-methyl-1H-imidazol-2-yl)ethanone |
|---|---|
| PubChem CID | 58386929 |
| Molecular Formula | C24H31N3O5S2 |
| Molecular Weight | 505.66 g/mol |
| Exact Mass | 505.17 |
| IUPAC Name | 2-[2-(4,4-dimethylcyclohexen-1-yl)-4-(2-methyl-1,1,3,3-tetraoxo-1,3,2-dithiazinan-5-yl)phenyl]-1-(5-methyl-1H-imidazol-2-yl)ethanone |
| SMILES | Cc1cnc(C(=O)Cc2ccc(C3CS(=O)(=O)N(C)S(=O)(=O)C3)cc2C2=CCC(C)(C)CC2)[nH]1 |
| InChI | InChI=1S/C24H31N3O5S2/c1-16-13-25-23(26-16)22(28)12-19-6-5-18(11-21(19)17-7-9-24(2,3)10-8-17)20-14-33(29,30)27(4)34(31,32)15-20/h5-7,11,13,20H,8-10,12,14-15H2,1-4H3,(H,25,26) |
| InChIKey | BJPGEUWPIYXLRP-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 117.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.66 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |