C29H36N4O4Si — CID 58386935
2-[2-[2-(cyclohexen-1-yl)-4-(2,6-dioxopiperidin-4-yl)phenyl]acetyl]-1-(2-trimethylsilylethoxymethyl)imidazole-4-carbonitrile (PubChem CID 58386935) has the molecular formula C29H36N4O4Si and a molecular weight of 532.72 g/mol. Its IUPAC name is 2-[2-[2-(cyclohexen-1-yl)-4-(2,6-dioxopiperidin-4-yl)phenyl]acetyl]-1-(2-trimethylsilylethoxymethyl)imidazole-4-carbonitrile.
| Compound Name | 2-[2-[2-(cyclohexen-1-yl)-4-(2,6-dioxopiperidin-4-yl)phenyl]acetyl]-1-(2-trimethylsilylethoxymethyl)imidazole-4-carbonitrile |
|---|---|
| PubChem CID | 58386935 |
| Molecular Formula | C29H36N4O4Si |
| Molecular Weight | 532.72 g/mol |
| Exact Mass | 532.25 |
| IUPAC Name | 2-[2-[2-(cyclohexen-1-yl)-4-(2,6-dioxopiperidin-4-yl)phenyl]acetyl]-1-(2-trimethylsilylethoxymethyl)imidazole-4-carbonitrile |
| SMILES | C[Si](C)(C)CCOCn1cc(C#N)nc1C(=O)Cc1ccc(C2CC(=O)NC(=O)C2)cc1C1=CCCCC1 |
| InChI | InChI=1S/C29H36N4O4Si/c1-38(2,3)12-11-37-19-33-18-24(17-30)31-29(33)26(34)14-22-10-9-21(23-15-27(35)32-28(36)16-23)13-25(22)20-7-5-4-6-8-20/h7,9-10,13,18,23H,4-6,8,11-12,14-16,19H2,1-3H3,(H,32,35,36) |
| InChIKey | QUHUPEUNPFLBJU-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 114.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.72 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|