C29H37N7O2Si — CID 58386938
2-[2-(cyclohexen-1-yl)-4-[2-(isocyanoamino)-1,4,5,6-tetrahydropyrimidin-5-yl]phenyl]-1-[4-isocyano-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]ethanone (PubChem CID 58386938) has the molecular formula C29H37N7O2Si and a molecular weight of 543.75 g/mol. Its IUPAC name is 2-[2-(cyclohexen-1-yl)-4-[2-(isocyanoamino)-1,4,5,6-tetrahydropyrimidin-5-yl]phenyl]-1-[4-isocyano-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]ethanone.
| Compound Name | 2-[2-(cyclohexen-1-yl)-4-[2-(isocyanoamino)-1,4,5,6-tetrahydropyrimidin-5-yl]phenyl]-1-[4-isocyano-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]ethanone |
|---|---|
| PubChem CID | 58386938 |
| Molecular Formula | C29H37N7O2Si |
| Molecular Weight | 543.75 g/mol |
| Exact Mass | 543.28 |
| IUPAC Name | 2-[2-(cyclohexen-1-yl)-4-[2-(isocyanoamino)-1,4,5,6-tetrahydropyrimidin-5-yl]phenyl]-1-[4-isocyano-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]ethanone |
| SMILES | [C-]#[N+]NC1=NCC(c2ccc(CC(=O)c3nc([N+]#[C-])cn3COCC[Si](C)(C)C)c(C3=CCCCC3)c2)CN1 |
| InChI | InChI=1S/C29H37N7O2Si/c1-30-27-19-36(20-38-13-14-39(3,4)5)28(34-27)26(37)16-23-12-11-22(15-25(23)21-9-7-6-8-10-21)24-17-32-29(33-18-24)35-31-2/h9,11-12,15,19,24H,6-8,10,13-14,16-18,20H2,3-5H3,(H2,32,33,35) |
| InChIKey | QOFIHBMWTCDFHM-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.75 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|