C33H45N7O2Si — CID 58386942
2-[2-[2-(4,4-dimethylcyclohexen-1-yl)-4-(2-isocyanoimino-1,3-dimethyl-1,3-diazinan-5-yl)phenyl]acetyl]-1-(2-trimethylsilylethoxymethyl)imidazole-4-carbonitrile (PubChem CID 58386942) has the molecular formula C33H45N7O2Si and a molecular weight of 599.86 g/mol. Its IUPAC name is 2-[2-[2-(4,4-dimethylcyclohexen-1-yl)-4-(2-isocyanoimino-1,3-dimethyl-1,3-diazinan-5-yl)phenyl]acetyl]-1-(2-trimethylsilylethoxymethyl)imidazole-4-carbonitrile.
| Compound Name | 2-[2-[2-(4,4-dimethylcyclohexen-1-yl)-4-(2-isocyanoimino-1,3-dimethyl-1,3-diazinan-5-yl)phenyl]acetyl]-1-(2-trimethylsilylethoxymethyl)imidazole-4-carbonitrile |
|---|---|
| PubChem CID | 58386942 |
| Molecular Formula | C33H45N7O2Si |
| Molecular Weight | 599.86 g/mol |
| Exact Mass | 599.34 |
| IUPAC Name | 2-[2-[2-(4,4-dimethylcyclohexen-1-yl)-4-(2-isocyanoimino-1,3-dimethyl-1,3-diazinan-5-yl)phenyl]acetyl]-1-(2-trimethylsilylethoxymethyl)imidazole-4-carbonitrile |
| SMILES | [C-]#[N+]N=C1N(C)CC(c2ccc(CC(=O)c3nc(C#N)cn3COCC[Si](C)(C)C)c(C3=CCC(C)(C)CC3)c2)CN1C |
| InChI | InChI=1S/C33H45N7O2Si/c1-33(2)13-11-24(12-14-33)29-17-25(27-20-38(4)32(37-35-3)39(5)21-27)9-10-26(29)18-30(41)31-36-28(19-34)22-40(31)23-42-15-16-43(6,7)8/h9-11,17,22,27H,12-16,18,20-21,23H2,1-2,4-8H3/b37-32- |
| InChIKey | SEEVJEPYZKODBK-FTTXPQLCSA-N |
| XLogP | 6.24 |
| TPSA | 91.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.86 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|