C30H38N4O4Si — CID 58386973
2-[2-[2-(cyclohexen-1-yl)-4-(1-methyl-2,6-dioxopiperidin-4-yl)phenyl]acetyl]-1-(2-trimethylsilylethoxymethyl)imidazole-4-carbonitrile (PubChem CID 58386973) has the molecular formula C30H38N4O4Si and a molecular weight of 546.74 g/mol. Its IUPAC name is 2-[2-[2-(cyclohexen-1-yl)-4-(1-methyl-2,6-dioxopiperidin-4-yl)phenyl]acetyl]-1-(2-trimethylsilylethoxymethyl)imidazole-4-carbonitrile.
| Compound Name | 2-[2-[2-(cyclohexen-1-yl)-4-(1-methyl-2,6-dioxopiperidin-4-yl)phenyl]acetyl]-1-(2-trimethylsilylethoxymethyl)imidazole-4-carbonitrile |
|---|---|
| PubChem CID | 58386973 |
| Molecular Formula | C30H38N4O4Si |
| Molecular Weight | 546.74 g/mol |
| Exact Mass | 546.27 |
| IUPAC Name | 2-[2-[2-(cyclohexen-1-yl)-4-(1-methyl-2,6-dioxopiperidin-4-yl)phenyl]acetyl]-1-(2-trimethylsilylethoxymethyl)imidazole-4-carbonitrile |
| SMILES | CN1C(=O)CC(c2ccc(CC(=O)c3nc(C#N)cn3COCC[Si](C)(C)C)c(C3=CCCCC3)c2)CC1=O |
| InChI | InChI=1S/C30H38N4O4Si/c1-33-28(36)16-24(17-29(33)37)22-10-11-23(26(14-22)21-8-6-5-7-9-21)15-27(35)30-32-25(18-31)19-34(30)20-38-12-13-39(2,3)4/h8,10-11,14,19,24H,5-7,9,12-13,15-17,20H2,1-4H3 |
| InChIKey | DJXGVVVLYFGRQY-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 105.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.74 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|