C30H41N5O3Si — CID 58386986
2-[2-[2-(cyclohexen-1-yl)-4-(1,3-dimethyl-2-oxo-1,3-diazinan-5-yl)phenyl]acetyl]-1-(2-trimethylsilylethoxymethyl)imidazole-4-carbonitrile (PubChem CID 58386986) has the molecular formula C30H41N5O3Si and a molecular weight of 547.78 g/mol. Its IUPAC name is 2-[2-[2-(cyclohexen-1-yl)-4-(1,3-dimethyl-2-oxo-1,3-diazinan-5-yl)phenyl]acetyl]-1-(2-trimethylsilylethoxymethyl)imidazole-4-carbonitrile.
| Compound Name | 2-[2-[2-(cyclohexen-1-yl)-4-(1,3-dimethyl-2-oxo-1,3-diazinan-5-yl)phenyl]acetyl]-1-(2-trimethylsilylethoxymethyl)imidazole-4-carbonitrile |
|---|---|
| PubChem CID | 58386986 |
| Molecular Formula | C30H41N5O3Si |
| Molecular Weight | 547.78 g/mol |
| Exact Mass | 547.30 |
| IUPAC Name | 2-[2-[2-(cyclohexen-1-yl)-4-(1,3-dimethyl-2-oxo-1,3-diazinan-5-yl)phenyl]acetyl]-1-(2-trimethylsilylethoxymethyl)imidazole-4-carbonitrile |
| SMILES | CN1CC(c2ccc(CC(=O)c3nc(C#N)cn3COCC[Si](C)(C)C)c(C3=CCCCC3)c2)CN(C)C1=O |
| InChI | InChI=1S/C30H41N5O3Si/c1-33-18-25(19-34(2)30(33)37)23-11-12-24(27(15-23)22-9-7-6-8-10-22)16-28(36)29-32-26(17-31)20-35(29)21-38-13-14-39(3,4)5/h9,11-12,15,20,25H,6-8,10,13-14,16,18-19,21H2,1-5H3 |
| InChIKey | XGEWSKFXMYIWQP-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 91.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.78 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|