C28H37N5O3Si — CID 58386987
2-[2-[2-(cyclohexen-1-yl)-4-(2-oxo-1,3-diazinan-5-yl)phenyl]acetyl]-1-(2-trimethylsilylethoxymethyl)imidazole-4-carbonitrile (PubChem CID 58386987) has the molecular formula C28H37N5O3Si and a molecular weight of 519.72 g/mol. Its IUPAC name is 2-[2-[2-(cyclohexen-1-yl)-4-(2-oxo-1,3-diazinan-5-yl)phenyl]acetyl]-1-(2-trimethylsilylethoxymethyl)imidazole-4-carbonitrile.
| Compound Name | 2-[2-[2-(cyclohexen-1-yl)-4-(2-oxo-1,3-diazinan-5-yl)phenyl]acetyl]-1-(2-trimethylsilylethoxymethyl)imidazole-4-carbonitrile |
|---|---|
| PubChem CID | 58386987 |
| Molecular Formula | C28H37N5O3Si |
| Molecular Weight | 519.72 g/mol |
| Exact Mass | 519.27 |
| IUPAC Name | 2-[2-[2-(cyclohexen-1-yl)-4-(2-oxo-1,3-diazinan-5-yl)phenyl]acetyl]-1-(2-trimethylsilylethoxymethyl)imidazole-4-carbonitrile |
| SMILES | C[Si](C)(C)CCOCn1cc(C#N)nc1C(=O)Cc1ccc(C2CNC(=O)NC2)cc1C1=CCCCC1 |
| InChI | InChI=1S/C28H37N5O3Si/c1-37(2,3)12-11-36-19-33-18-24(15-29)32-27(33)26(34)14-22-10-9-21(23-16-30-28(35)31-17-23)13-25(22)20-7-5-4-6-8-20/h7,9-10,13,18,23H,4-6,8,11-12,14,16-17,19H2,1-3H3,(H2,30,31,35) |
| InChIKey | QJWHVQUVPLRSFH-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 109.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.72 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|