C24H17N3OS — CID 58387591
2-[6-(4-phenylmethoxyquinolin-6-yl)-2-pyridinyl]-1,3-thiazole (PubChem CID 58387591) has the molecular formula C24H17N3OS and a molecular weight of 395.49 g/mol. Its IUPAC name is 2-[6-(4-phenylmethoxyquinolin-6-yl)-2-pyridinyl]-1,3-thiazole.
| Compound Name | 2-[6-(4-phenylmethoxyquinolin-6-yl)-2-pyridinyl]-1,3-thiazole |
|---|---|
| PubChem CID | 58387591 |
| Molecular Formula | C24H17N3OS |
| Molecular Weight | 395.49 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | 2-[6-(4-phenylmethoxyquinolin-6-yl)-2-pyridinyl]-1,3-thiazole |
| SMILES | c1ccc(COc2ccnc3ccc(-c4cccc(-c5nccs5)n4)cc23)cc1 |
| InChI | InChI=1S/C24H17N3OS/c1-2-5-17(6-3-1)16-28-23-11-12-25-21-10-9-18(15-19(21)23)20-7-4-8-22(27-20)24-26-13-14-29-24/h1-15H,16H2 |
| InChIKey | NGJDBEPBSXAKJA-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.49 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |