About 1,3-dimethyl-4-oxocyclohexa-2,5-diene-1-carboxamide
1,3-dimethyl-4-oxocyclohexa-2,5-diene-1-carboxamide (PubChem CID 58388165) has the molecular formula C9H11NO2
and a molecular weight of 165.19 g/mol. Its IUPAC name is 1,3-dimethyl-4-oxocyclohexa-2,5-diene-1-carboxamide.
Molecular Properties
| Compound Name | 1,3-dimethyl-4-oxocyclohexa-2,5-diene-1-carboxamide |
| PubChem CID | 58388165 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | 1,3-dimethyl-4-oxocyclohexa-2,5-diene-1-carboxamide |
| SMILES | CC1=CC(C)(C(N)=O)C=CC1=O |
| InChI | InChI=1S/C9H11NO2/c1-6-5-9(2,8(10)12)4-3-7(6)11/h3-5H,1-2H3,(H2,10,12) |
| InChIKey | ODPSBTYDNQUYEU-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,3-dimethyl-4-oxocyclohexa-2,5-diene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethyl-4-oxocyclohexa-2,5-diene-1-carboxamide?
The IUPAC name of 1,3-dimethyl-4-oxocyclohexa-2,5-diene-1-carboxamide (CID 58388165) is 1,3-dimethyl-4-oxocyclohexa-2,5-diene-1-carboxamide.
What is the SMILES notation for 1,3-dimethyl-4-oxocyclohexa-2,5-diene-1-carboxamide?
The canonical SMILES for 1,3-dimethyl-4-oxocyclohexa-2,5-diene-1-carboxamide is CC1=CC(C)(C(N)=O)C=CC1=O.
What is the InChIKey of 1,3-dimethyl-4-oxocyclohexa-2,5-diene-1-carboxamide?
The InChIKey is ODPSBTYDNQUYEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2/c1-6-5-9(2,8(10)12)4-3-7(6)11/h3-5H,1-2H3,(H2,10,12).
What are the key properties of 1,3-dimethyl-4-oxocyclohexa-2,5-diene-1-carboxamide?
1,3-dimethyl-4-oxocyclohexa-2,5-diene-1-carboxamide has a molecular weight of 165.19 g/mol, XLogP of 0.56, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethyl-4-oxocyclohexa-2,5-diene-1-carboxamide is sourced from PubChem (CID 58388165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).