About 2-hydroxy-5,5-dimethylcyclohexa-1,3-diene-1-carbonitrile
2-hydroxy-5,5-dimethylcyclohexa-1,3-diene-1-carbonitrile (PubChem CID 58388179) has the molecular formula C9H11NO
and a molecular weight of 149.19 g/mol. Its IUPAC name is 2-hydroxy-5,5-dimethylcyclohexa-1,3-diene-1-carbonitrile.
Molecular Properties
| Compound Name | 2-hydroxy-5,5-dimethylcyclohexa-1,3-diene-1-carbonitrile |
| PubChem CID | 58388179 |
| Molecular Formula | C9H11NO |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.08 |
| IUPAC Name | 2-hydroxy-5,5-dimethylcyclohexa-1,3-diene-1-carbonitrile |
| SMILES | CC1(C)C=CC(O)=C(C#N)C1 |
| InChI | InChI=1S/C9H11NO/c1-9(2)4-3-8(11)7(5-9)6-10/h3-4,11H,5H2,1-2H3 |
| InChIKey | VYEJOISPSPCWJT-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-hydroxy-5,5-dimethylcyclohexa-1,3-diene-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-5,5-dimethylcyclohexa-1,3-diene-1-carbonitrile?
The IUPAC name of 2-hydroxy-5,5-dimethylcyclohexa-1,3-diene-1-carbonitrile (CID 58388179) is 2-hydroxy-5,5-dimethylcyclohexa-1,3-diene-1-carbonitrile.
What is the SMILES notation for 2-hydroxy-5,5-dimethylcyclohexa-1,3-diene-1-carbonitrile?
The canonical SMILES for 2-hydroxy-5,5-dimethylcyclohexa-1,3-diene-1-carbonitrile is CC1(C)C=CC(O)=C(C#N)C1.
What is the InChIKey of 2-hydroxy-5,5-dimethylcyclohexa-1,3-diene-1-carbonitrile?
The InChIKey is VYEJOISPSPCWJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO/c1-9(2)4-3-8(11)7(5-9)6-10/h3-4,11H,5H2,1-2H3.
What are the key properties of 2-hydroxy-5,5-dimethylcyclohexa-1,3-diene-1-carbonitrile?
2-hydroxy-5,5-dimethylcyclohexa-1,3-diene-1-carbonitrile has a molecular weight of 149.19 g/mol, XLogP of 2.31, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-5,5-dimethylcyclohexa-1,3-diene-1-carbonitrile is sourced from PubChem (CID 58388179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).