About 6-hydroxy-3,3-dimethylcyclohexa-1,4-diene-1-carbonitrile
6-hydroxy-3,3-dimethylcyclohexa-1,4-diene-1-carbonitrile (PubChem CID 58388206) has the molecular formula C9H11NO
and a molecular weight of 149.19 g/mol. Its IUPAC name is 6-hydroxy-3,3-dimethylcyclohexa-1,4-diene-1-carbonitrile.
Molecular Properties
| Compound Name | 6-hydroxy-3,3-dimethylcyclohexa-1,4-diene-1-carbonitrile |
| PubChem CID | 58388206 |
| Molecular Formula | C9H11NO |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.08 |
| IUPAC Name | 6-hydroxy-3,3-dimethylcyclohexa-1,4-diene-1-carbonitrile |
| SMILES | CC1(C)C=CC(O)C(C#N)=C1 |
| InChI | InChI=1S/C9H11NO/c1-9(2)4-3-8(11)7(5-9)6-10/h3-5,8,11H,1-2H3 |
| InChIKey | SUZCMMFGSGYUTI-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-hydroxy-3,3-dimethylcyclohexa-1,4-diene-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydroxy-3,3-dimethylcyclohexa-1,4-diene-1-carbonitrile?
The IUPAC name of 6-hydroxy-3,3-dimethylcyclohexa-1,4-diene-1-carbonitrile (CID 58388206) is 6-hydroxy-3,3-dimethylcyclohexa-1,4-diene-1-carbonitrile.
What is the SMILES notation for 6-hydroxy-3,3-dimethylcyclohexa-1,4-diene-1-carbonitrile?
The canonical SMILES for 6-hydroxy-3,3-dimethylcyclohexa-1,4-diene-1-carbonitrile is CC1(C)C=CC(O)C(C#N)=C1.
What is the InChIKey of 6-hydroxy-3,3-dimethylcyclohexa-1,4-diene-1-carbonitrile?
The InChIKey is SUZCMMFGSGYUTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO/c1-9(2)4-3-8(11)7(5-9)6-10/h3-5,8,11H,1-2H3.
What are the key properties of 6-hydroxy-3,3-dimethylcyclohexa-1,4-diene-1-carbonitrile?
6-hydroxy-3,3-dimethylcyclohexa-1,4-diene-1-carbonitrile has a molecular weight of 149.19 g/mol, XLogP of 1.39, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxy-3,3-dimethylcyclohexa-1,4-diene-1-carbonitrile is sourced from PubChem (CID 58388206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).