C11H15NO — CID 58388207
2-isocyano-4,4,6,6-tetramethylcyclohex-2-en-1-one (PubChem CID 58388207) has the molecular formula C11H15NO and a molecular weight of 177.25 g/mol. Its IUPAC name is 2-isocyano-4,4,6,6-tetramethylcyclohex-2-en-1-one.
| Compound Name | 2-isocyano-4,4,6,6-tetramethylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 58388207 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | 2-isocyano-4,4,6,6-tetramethylcyclohex-2-en-1-one |
| SMILES | [C-]#[N+]C1=CC(C)(C)CC(C)(C)C1=O |
| InChI | InChI=1S/C11H15NO/c1-10(2)6-8(12-5)9(13)11(3,4)7-10/h6H,7H2,1-4H3 |
| InChIKey | CHJPYDXTROQCIG-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 21.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|