C17H23FO2 — CID 58388363
(1S,3aR,5S,7aS)-5-(3-fluoro-4-hydroxy-2-methylphenyl)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-ol (PubChem CID 58388363) has the molecular formula C17H23FO2 and a molecular weight of 278.37 g/mol. Its IUPAC name is (1S,3aR,5S,7aS)-5-(3-fluoro-4-hydroxy-2-methylphenyl)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-ol.
| Compound Name | (1S,3aR,5S,7aS)-5-(3-fluoro-4-hydroxy-2-methylphenyl)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-ol |
|---|---|
| PubChem CID | 58388363 |
| Molecular Formula | C17H23FO2 |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | (1S,3aR,5S,7aS)-5-(3-fluoro-4-hydroxy-2-methylphenyl)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-ol |
| SMILES | Cc1c([C@H]2CC[C@@]3(C)[C@H](CC[C@@H]3O)C2)ccc(O)c1F |
| InChI | InChI=1S/C17H23FO2/c1-10-13(4-5-14(19)16(10)18)11-7-8-17(2)12(9-11)3-6-15(17)20/h4-5,11-12,15,19-20H,3,6-9H2,1-2H3/t11-,12+,15-,17-/m0/s1 |
| InChIKey | VAFBHHVFLCDVIV-RBNVPPIJSA-N |
| XLogP | 3.88 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |