C12H9F9O3 — CID 58388534
3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-5-(1,1,1-trifluoro-2-hydroxypropan-2-yl)phenol (PubChem CID 58388534) has the molecular formula C12H9F9O3 and a molecular weight of 372.18 g/mol. Its IUPAC name is 3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-5-(1,1,1-trifluoro-2-hydroxypropan-2-yl)phenol.
| Compound Name | 3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-5-(1,1,1-trifluoro-2-hydroxypropan-2-yl)phenol |
|---|---|
| PubChem CID | 58388534 |
| Molecular Formula | C12H9F9O3 |
| Molecular Weight | 372.18 g/mol |
| Exact Mass | 372.04 |
| IUPAC Name | 3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-5-(1,1,1-trifluoro-2-hydroxypropan-2-yl)phenol |
| SMILES | CC(O)(c1cc(O)cc(C(O)(C(F)(F)F)C(F)(F)F)c1)C(F)(F)F |
| InChI | InChI=1S/C12H9F9O3/c1-8(23,10(13,14)15)5-2-6(4-7(22)3-5)9(24,11(16,17)18)12(19,20)21/h2-4,22-24H,1H3 |
| InChIKey | CZWLAPBBXPWWRX-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.18 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |