C14H17F9O2 — CID 58388543
2-[3-ethenyl-5-(1,1,1-trifluoro-2-hydroxypropan-2-yl)cyclohexyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 58388543) has the molecular formula C14H17F9O2 and a molecular weight of 388.27 g/mol. Its IUPAC name is 2-[3-ethenyl-5-(1,1,1-trifluoro-2-hydroxypropan-2-yl)cyclohexyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[3-ethenyl-5-(1,1,1-trifluoro-2-hydroxypropan-2-yl)cyclohexyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 58388543 |
| Molecular Formula | C14H17F9O2 |
| Molecular Weight | 388.27 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | 2-[3-ethenyl-5-(1,1,1-trifluoro-2-hydroxypropan-2-yl)cyclohexyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | C=CC1CC(C(C)(O)C(F)(F)F)CC(C(O)(C(F)(F)F)C(F)(F)F)C1 |
| InChI | InChI=1S/C14H17F9O2/c1-3-7-4-8(10(2,24)12(15,16)17)6-9(5-7)11(25,13(18,19)20)14(21,22)23/h3,7-9,24-25H,1,4-6H2,2H3 |
| InChIKey | GMOUWAUVPUIMLK-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.27 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|