C13H14F12O5S — CID 58388557
[3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-5-(1,1,1-trifluoro-2-hydroxypropan-2-yl)cyclohexyl] trifluoromethanesulfonate (PubChem CID 58388557) has the molecular formula C13H14F12O5S and a molecular weight of 510.29 g/mol. Its IUPAC name is [3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-5-(1,1,1-trifluoro-2-hydroxypropan-2-yl)cyclohexyl] trifluoromethanesulfonate.
| Compound Name | [3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-5-(1,1,1-trifluoro-2-hydroxypropan-2-yl)cyclohexyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 58388557 |
| Molecular Formula | C13H14F12O5S |
| Molecular Weight | 510.29 g/mol |
| Exact Mass | 510.04 |
| IUPAC Name | [3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-5-(1,1,1-trifluoro-2-hydroxypropan-2-yl)cyclohexyl] trifluoromethanesulfonate |
| SMILES | CC(O)(C1CC(OS(=O)(=O)C(F)(F)F)CC(C(O)(C(F)(F)F)C(F)(F)F)C1)C(F)(F)F |
| InChI | InChI=1S/C13H14F12O5S/c1-8(26,10(14,15)16)5-2-6(9(27,11(17,18)19)12(20,21)22)4-7(3-5)30-31(28,29)13(23,24)25/h5-7,26-27H,2-4H2,1H3 |
| InChIKey | GSWJVHCKKNNZGQ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.29 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|