C20H27F9O5 — CID 58388561
[2-[3-(1-ethoxyethoxy)-5-(2-hydroxypropan-2-yl)cyclohexyl]-1,1,1,3,3,3-hexafluoropropan-2-yl] 2-(trifluoromethyl)prop-2-enoate (PubChem CID 58388561) has the molecular formula C20H27F9O5 and a molecular weight of 518.41 g/mol. Its IUPAC name is [2-[3-(1-ethoxyethoxy)-5-(2-hydroxypropan-2-yl)cyclohexyl]-1,1,1,3,3,3-hexafluoropropan-2-yl] 2-(trifluoromethyl)prop-2-enoate.
| Compound Name | [2-[3-(1-ethoxyethoxy)-5-(2-hydroxypropan-2-yl)cyclohexyl]-1,1,1,3,3,3-hexafluoropropan-2-yl] 2-(trifluoromethyl)prop-2-enoate |
|---|---|
| PubChem CID | 58388561 |
| Molecular Formula | C20H27F9O5 |
| Molecular Weight | 518.41 g/mol |
| Exact Mass | 518.17 |
| IUPAC Name | [2-[3-(1-ethoxyethoxy)-5-(2-hydroxypropan-2-yl)cyclohexyl]-1,1,1,3,3,3-hexafluoropropan-2-yl] 2-(trifluoromethyl)prop-2-enoate |
| SMILES | C=C(C(=O)OC(C1CC(OC(C)OCC)CC(C(C)(C)O)C1)(C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C20H27F9O5/c1-6-32-11(3)33-14-8-12(16(4,5)31)7-13(9-14)17(19(24,25)26,20(27,28)29)34-15(30)10(2)18(21,22)23/h11-14,31H,2,6-9H2,1,3-5H3 |
| InChIKey | UDHAOAKOOVHBAW-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.41 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|