C19H23F9O6 — CID 58388563
[2-[3-ethoxycarbonyloxy-5-(2-hydroxypropan-2-yl)cyclohexyl]-1,1,1,3,3,3-hexafluoropropan-2-yl] 2-(trifluoromethyl)prop-2-enoate (PubChem CID 58388563) has the molecular formula C19H23F9O6 and a molecular weight of 518.37 g/mol. Its IUPAC name is [2-[3-ethoxycarbonyloxy-5-(2-hydroxypropan-2-yl)cyclohexyl]-1,1,1,3,3,3-hexafluoropropan-2-yl] 2-(trifluoromethyl)prop-2-enoate.
| Compound Name | [2-[3-ethoxycarbonyloxy-5-(2-hydroxypropan-2-yl)cyclohexyl]-1,1,1,3,3,3-hexafluoropropan-2-yl] 2-(trifluoromethyl)prop-2-enoate |
|---|---|
| PubChem CID | 58388563 |
| Molecular Formula | C19H23F9O6 |
| Molecular Weight | 518.37 g/mol |
| Exact Mass | 518.14 |
| IUPAC Name | [2-[3-ethoxycarbonyloxy-5-(2-hydroxypropan-2-yl)cyclohexyl]-1,1,1,3,3,3-hexafluoropropan-2-yl] 2-(trifluoromethyl)prop-2-enoate |
| SMILES | C=C(C(=O)OC(C1CC(OC(=O)OCC)CC(C(C)(C)O)C1)(C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C19H23F9O6/c1-5-32-14(30)33-12-7-10(15(3,4)31)6-11(8-12)16(18(23,24)25,19(26,27)28)34-13(29)9(2)17(20,21)22/h10-12,31H,2,5-8H2,1,3-4H3 |
| InChIKey | VZYGEPYGWOLUJD-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.37 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|