About (8-chloro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)phosphane
(8-chloro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)phosphane (PubChem CID 58388823) has the molecular formula C5H4ClN4P
and a molecular weight of 186.54 g/mol. Its IUPAC name is (8-chloro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)phosphane.
Molecular Properties
| Compound Name | (8-chloro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)phosphane |
| PubChem CID | 58388823 |
| Molecular Formula | C5H4ClN4P |
| Molecular Weight | 186.54 g/mol |
| Exact Mass | 185.99 |
| IUPAC Name | (8-chloro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)phosphane |
| SMILES | Pc1nnc2c(Cl)nccn12 |
| InChI | InChI=1S/C5H4ClN4P/c6-3-4-8-9-5(11)10(4)2-1-7-3/h1-2H,11H2 |
| InChIKey | BHBAKTVMQANBMI-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.54 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (8-chloro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8-chloro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)phosphane?
The IUPAC name of (8-chloro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)phosphane (CID 58388823) is (8-chloro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)phosphane.
What is the SMILES notation for (8-chloro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)phosphane?
The canonical SMILES for (8-chloro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)phosphane is Pc1nnc2c(Cl)nccn12.
What is the InChIKey of (8-chloro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)phosphane?
The InChIKey is BHBAKTVMQANBMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4ClN4P/c6-3-4-8-9-5(11)10(4)2-1-7-3/h1-2H,11H2.
What are the key properties of (8-chloro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)phosphane?
(8-chloro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)phosphane has a molecular weight of 186.54 g/mol, XLogP of 0.28, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (8-chloro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)phosphane is sourced from PubChem (CID 58388823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).