C21H17F2NO4 — CID 58388948
4-[7-[(3,4-difluorophenyl)methoxy]-3-oxo-1H-isoindol-2-yl]cyclohexane-1,3-dione (PubChem CID 58388948) has the molecular formula C21H17F2NO4 and a molecular weight of 385.37 g/mol. Its IUPAC name is 4-[7-[(3,4-difluorophenyl)methoxy]-3-oxo-1H-isoindol-2-yl]cyclohexane-1,3-dione.
| Compound Name | 4-[7-[(3,4-difluorophenyl)methoxy]-3-oxo-1H-isoindol-2-yl]cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 58388948 |
| Molecular Formula | C21H17F2NO4 |
| Molecular Weight | 385.37 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | 4-[7-[(3,4-difluorophenyl)methoxy]-3-oxo-1H-isoindol-2-yl]cyclohexane-1,3-dione |
| SMILES | O=C1CCC(N2Cc3c(OCc4ccc(F)c(F)c4)cccc3C2=O)C(=O)C1 |
| InChI | InChI=1S/C21H17F2NO4/c22-16-6-4-12(8-17(16)23)11-28-20-3-1-2-14-15(20)10-24(21(14)27)18-7-5-13(25)9-19(18)26/h1-4,6,8,18H,5,7,9-11H2 |
| InChIKey | SBYYTWGQWXTPMP-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.37 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|