C28H28F6N2O4 — CID 58388994
4-[7-[[4-[[bis(3,3,3-trifluoropropyl)amino]methyl]phenyl]methoxy]-3-oxo-1H-isoindol-2-yl]cyclohexane-1,3-dione (PubChem CID 58388994) has the molecular formula C28H28F6N2O4 and a molecular weight of 570.53 g/mol. Its IUPAC name is 4-[7-[[4-[[bis(3,3,3-trifluoropropyl)amino]methyl]phenyl]methoxy]-3-oxo-1H-isoindol-2-yl]cyclohexane-1,3-dione.
| Compound Name | 4-[7-[[4-[[bis(3,3,3-trifluoropropyl)amino]methyl]phenyl]methoxy]-3-oxo-1H-isoindol-2-yl]cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 58388994 |
| Molecular Formula | C28H28F6N2O4 |
| Molecular Weight | 570.53 g/mol |
| Exact Mass | 570.20 |
| IUPAC Name | 4-[7-[[4-[[bis(3,3,3-trifluoropropyl)amino]methyl]phenyl]methoxy]-3-oxo-1H-isoindol-2-yl]cyclohexane-1,3-dione |
| SMILES | O=C1CCC(N2Cc3c(OCc4ccc(CN(CCC(F)(F)F)CCC(F)(F)F)cc4)cccc3C2=O)C(=O)C1 |
| InChI | InChI=1S/C28H28F6N2O4/c29-27(30,31)10-12-35(13-11-28(32,33)34)15-18-4-6-19(7-5-18)17-40-25-3-1-2-21-22(25)16-36(26(21)39)23-9-8-20(37)14-24(23)38/h1-7,23H,8-17H2 |
| InChIKey | DUSRCKZFISHAFS-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.53 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|