C33H32F2N2O4 — CID 58389111
4-[7-[[4-[[4-(3,5-difluorophenyl)piperidin-1-yl]methyl]phenyl]methoxy]-3-oxo-1H-isoindol-2-yl]cyclohexane-1,3-dione (PubChem CID 58389111) has the molecular formula C33H32F2N2O4 and a molecular weight of 558.63 g/mol. Its IUPAC name is 4-[7-[[4-[[4-(3,5-difluorophenyl)piperidin-1-yl]methyl]phenyl]methoxy]-3-oxo-1H-isoindol-2-yl]cyclohexane-1,3-dione.
| Compound Name | 4-[7-[[4-[[4-(3,5-difluorophenyl)piperidin-1-yl]methyl]phenyl]methoxy]-3-oxo-1H-isoindol-2-yl]cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 58389111 |
| Molecular Formula | C33H32F2N2O4 |
| Molecular Weight | 558.63 g/mol |
| Exact Mass | 558.23 |
| IUPAC Name | 4-[7-[[4-[[4-(3,5-difluorophenyl)piperidin-1-yl]methyl]phenyl]methoxy]-3-oxo-1H-isoindol-2-yl]cyclohexane-1,3-dione |
| SMILES | O=C1CCC(N2Cc3c(OCc4ccc(CN5CCC(c6cc(F)cc(F)c6)CC5)cc4)cccc3C2=O)C(=O)C1 |
| InChI | InChI=1S/C33H32F2N2O4/c34-25-14-24(15-26(35)16-25)23-10-12-36(13-11-23)18-21-4-6-22(7-5-21)20-41-32-3-1-2-28-29(32)19-37(33(28)40)30-9-8-27(38)17-31(30)39/h1-7,14-16,23,30H,8-13,17-20H2 |
| InChIKey | UKWBNXZXXFBLBU-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.63 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|