C45H30N4Si2 — CID 58389790
8-phenyl-8-[6-(8-phenyl-3,13-diaza-8-silatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-yl)-9H-fluoren-3-yl]-3,13-diaza-8-silatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene (PubChem CID 58389790) has the molecular formula C45H30N4Si2 and a molecular weight of 682.94 g/mol. Its IUPAC name is 8-phenyl-8-[6-(8-phenyl-3,13-diaza-8-silatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-yl)-9H-fluoren-3-yl]-3,13-diaza-8-silatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene.
| Compound Name | 8-phenyl-8-[6-(8-phenyl-3,13-diaza-8-silatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-yl)-9H-fluoren-3-yl]-3,13-diaza-8-silatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
|---|---|
| PubChem CID | 58389790 |
| Molecular Formula | C45H30N4Si2 |
| Molecular Weight | 682.94 g/mol |
| Exact Mass | 682.20 |
| IUPAC Name | 8-phenyl-8-[6-(8-phenyl-3,13-diaza-8-silatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-yl)-9H-fluoren-3-yl]-3,13-diaza-8-silatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
| SMILES | c1ccc([Si]2(c3ccc4c(c3)-c3cc([Si]5(c6ccccc6)c6cccnc6-c6ncccc65)ccc3C4)c3cccnc3-c3ncccc32)cc1 |
| InChI | InChI=1S/C45H30N4Si2/c1-3-11-32(12-4-1)50(38-15-7-23-46-42(38)43-39(50)16-8-24-47-43)34-21-19-30-27-31-20-22-35(29-37(31)36(30)28-34)51(33-13-5-2-6-14-33)40-17-9-25-48-44(40)45-41(51)18-10-26-49-45/h1-26,28-29H,27H2 |
| InChIKey | DXOJNJBHEBERRC-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.94 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|