C64H60 — CID 58390239
7,12-bis(3,5-ditert-butylphenyl)-3-fluoranthen-8-ylbenzo[k]fluoranthene (PubChem CID 58390239) has the molecular formula C64H60 and a molecular weight of 829.18 g/mol. Its IUPAC name is 7,12-bis(3,5-ditert-butylphenyl)-3-fluoranthen-8-ylbenzo[k]fluoranthene.
| Compound Name | 7,12-bis(3,5-ditert-butylphenyl)-3-fluoranthen-8-ylbenzo[k]fluoranthene |
|---|---|
| PubChem CID | 58390239 |
| Molecular Formula | C64H60 |
| Molecular Weight | 829.18 g/mol |
| Exact Mass | 828.47 |
| IUPAC Name | 7,12-bis(3,5-ditert-butylphenyl)-3-fluoranthen-8-ylbenzo[k]fluoranthene |
| SMILES | CC(C)(C)c1cc(-c2c3c(c(-c4cc(C(C)(C)C)cc(C(C)(C)C)c4)c4ccccc24)-c2ccc(-c4ccc5c(c4)-c4cccc6cccc-5c46)c4cccc-3c24)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C64H60/c1-61(2,3)41-30-39(31-42(35-41)62(4,5)6)56-49-20-13-14-21-50(49)57(40-32-43(63(7,8)9)36-44(33-40)64(10,11)12)60-53-29-28-45(47-24-17-25-52(58(47)53)59(56)60)38-26-27-46-48-22-15-18-37-19-16-23-51(55(37)48)54(46)34-38/h13-36H,1-12H3 |
| InChIKey | XIRZLKJRNFSTQI-UHFFFAOYSA-N |
| XLogP | 18.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 829.18 |
| LogP ≤ 5 | 18.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |