C21H10F6IrN3- — CID 58390274
iridium;4-phenyl-3-[4-(trifluoromethyl)benzene-6-id-1-yl]-5-(2,3,5-trifluorophenyl)-1,2,4-triazole (PubChem CID 58390274) has the molecular formula C21H10F6IrN3- and a molecular weight of 610.54 g/mol. Its IUPAC name is iridium;4-phenyl-3-[4-(trifluoromethyl)benzene-6-id-1-yl]-5-(2,3,5-trifluorophenyl)-1,2,4-triazole.
| Compound Name | iridium;4-phenyl-3-[4-(trifluoromethyl)benzene-6-id-1-yl]-5-(2,3,5-trifluorophenyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 58390274 |
| Molecular Formula | C21H10F6IrN3- |
| Molecular Weight | 610.54 g/mol |
| Exact Mass | 611.04 |
| IUPAC Name | iridium;4-phenyl-3-[4-(trifluoromethyl)benzene-6-id-1-yl]-5-(2,3,5-trifluorophenyl)-1,2,4-triazole |
| SMILES | Fc1cc(F)c(F)c(-c2nnc(-c3[c-]cc(C(F)(F)F)cc3)n2-c2ccccc2)c1.[Ir] |
| InChI | InChI=1S/C21H10F6N3.Ir/c22-14-10-16(18(24)17(23)11-14)20-29-28-19(30(20)15-4-2-1-3-5-15)12-6-8-13(9-7-12)21(25,26)27;/h1-6,8-11H;/q-1; |
| InChIKey | JABGVLMUGCXLCE-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.54 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|