C27H39NO4 — CID 58390573
N-[[(3R,5S)-3,5-bis(3-oxobutyl)-7-(3-oxohex-5-ynyl)-1-adamantyl]methyl]acetamide (PubChem CID 58390573) has the molecular formula C27H39NO4 and a molecular weight of 441.61 g/mol. Its IUPAC name is N-[[(3R,5S)-3,5-bis(3-oxobutyl)-7-(3-oxohex-5-ynyl)-1-adamantyl]methyl]acetamide.
| Compound Name | N-[[(3R,5S)-3,5-bis(3-oxobutyl)-7-(3-oxohex-5-ynyl)-1-adamantyl]methyl]acetamide |
|---|---|
| PubChem CID | 58390573 |
| Molecular Formula | C27H39NO4 |
| Molecular Weight | 441.61 g/mol |
| Exact Mass | 441.29 |
| IUPAC Name | N-[[(3R,5S)-3,5-bis(3-oxobutyl)-7-(3-oxohex-5-ynyl)-1-adamantyl]methyl]acetamide |
| SMILES | C#CCC(=O)CCC12CC3(CNC(C)=O)C[C@](CCC(C)=O)(C1)C[C@](CCC(C)=O)(C2)C3 |
| InChI | InChI=1S/C27H39NO4/c1-5-6-23(32)9-12-26-14-24(10-7-20(2)29)13-25(15-26,11-8-21(3)30)17-27(16-24,18-26)19-28-22(4)31/h1H,6-19H2,2-4H3,(H,28,31)/t24-,25+,26?,27? |
| InChIKey | XFMGNCVWQOIJOA-HTTSFZEZSA-N |
| XLogP | 4.56 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.61 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|