C16H19NO2 — CID 58390815
tert-butyl (E)-3-(4-cyano-2,6-dimethylphenyl)prop-2-enoate (PubChem CID 58390815) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is tert-butyl (E)-3-(4-cyano-2,6-dimethylphenyl)prop-2-enoate.
| Compound Name | tert-butyl (E)-3-(4-cyano-2,6-dimethylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 58390815 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | tert-butyl (E)-3-(4-cyano-2,6-dimethylphenyl)prop-2-enoate |
| SMILES | Cc1cc(C#N)cc(C)c1/C=C/C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H19NO2/c1-11-8-13(10-17)9-12(2)14(11)6-7-15(18)19-16(3,4)5/h6-9H,1-5H3/b7-6+ |
| InChIKey | NWBBTHHCGQSIAM-VOTSOKGWSA-N |
| XLogP | 3.53 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|