C17H22N2S — CID 58390924
2-(4-ethenyl-3,5-dimethylphenyl)-5-pentyl-1,3,4-thiadiazole (PubChem CID 58390924) has the molecular formula C17H22N2S and a molecular weight of 286.44 g/mol. Its IUPAC name is 2-(4-ethenyl-3,5-dimethylphenyl)-5-pentyl-1,3,4-thiadiazole.
| Compound Name | 2-(4-ethenyl-3,5-dimethylphenyl)-5-pentyl-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 58390924 |
| Molecular Formula | C17H22N2S |
| Molecular Weight | 286.44 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 2-(4-ethenyl-3,5-dimethylphenyl)-5-pentyl-1,3,4-thiadiazole |
| SMILES | C=Cc1c(C)cc(-c2nnc(CCCCC)s2)cc1C |
| InChI | InChI=1S/C17H22N2S/c1-5-7-8-9-16-18-19-17(20-16)14-10-12(3)15(6-2)13(4)11-14/h6,10-11H,2,5,7-9H2,1,3-4H3 |
| InChIKey | POUSNKHQIXHPMH-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.44 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|