C16H20N2S — CID 58390946
2-(4-ethenyl-2-methylphenyl)-5-pentyl-1,3,4-thiadiazole (PubChem CID 58390946) has the molecular formula C16H20N2S and a molecular weight of 272.42 g/mol. Its IUPAC name is 2-(4-ethenyl-2-methylphenyl)-5-pentyl-1,3,4-thiadiazole.
| Compound Name | 2-(4-ethenyl-2-methylphenyl)-5-pentyl-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 58390946 |
| Molecular Formula | C16H20N2S |
| Molecular Weight | 272.42 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 2-(4-ethenyl-2-methylphenyl)-5-pentyl-1,3,4-thiadiazole |
| SMILES | C=Cc1ccc(-c2nnc(CCCCC)s2)c(C)c1 |
| InChI | InChI=1S/C16H20N2S/c1-4-6-7-8-15-17-18-16(19-15)14-10-9-13(5-2)11-12(14)3/h5,9-11H,2,4,6-8H2,1,3H3 |
| InChIKey | VJNQWZIYEHWSKF-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.42 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|