About pentanethiohydrazide
pentanethiohydrazide (PubChem CID 58390990) has the molecular formula C5H12N2S
and a molecular weight of 132.23 g/mol. Its IUPAC name is pentanethiohydrazide.
Molecular Properties
| Compound Name | pentanethiohydrazide |
| PubChem CID | 58390990 |
| Molecular Formula | C5H12N2S |
| Molecular Weight | 132.23 g/mol |
| Exact Mass | 132.07 |
| IUPAC Name | pentanethiohydrazide |
| SMILES | CCCCC(=S)NN |
| InChI | InChI=1S/C5H12N2S/c1-2-3-4-5(8)7-6/h2-4,6H2,1H3,(H,7,8) |
| InChIKey | AEGMPRZRSIEOFS-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.23 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze pentanethiohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentanethiohydrazide?
The IUPAC name of pentanethiohydrazide (CID 58390990) is pentanethiohydrazide.
What is the SMILES notation for pentanethiohydrazide?
The canonical SMILES for pentanethiohydrazide is CCCCC(=S)NN.
What is the InChIKey of pentanethiohydrazide?
The InChIKey is AEGMPRZRSIEOFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N2S/c1-2-3-4-5(8)7-6/h2-4,6H2,1H3,(H,7,8).
What are the key properties of pentanethiohydrazide?
pentanethiohydrazide has a molecular weight of 132.23 g/mol, XLogP of 0.97, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pentanethiohydrazide is sourced from PubChem (CID 58390990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).