2,3-dimethyl-4-(methylamino)pentanoic acid

C8H17NO2 — CID 58391138

IUPAC2,3-dimethyl-4-(methylamino)pentanoic acid
SMILESCNC(C)C(C)C(C)C(=O)O
InChIInChI=1S/C8H17NO2/c1-5(7(3)9-4)6(2)8(10)11/h5-7,9H,1-4H3,(H,10,11)
InChIKeyKENMDUGATGTINA-UHFFFAOYSA-N
MW159.23 g/mol
LogP0.95
Rot. Bonds4

About 2,3-dimethyl-4-(methylamino)pentanoic acid

2,3-dimethyl-4-(methylamino)pentanoic acid (PubChem CID 58391138) has the molecular formula C8H17NO2 and a molecular weight of 159.23 g/mol. Its IUPAC name is 2,3-dimethyl-4-(methylamino)pentanoic acid.

Molecular Properties

Compound Name2,3-dimethyl-4-(methylamino)pentanoic acid
PubChem CID58391138
Molecular FormulaC8H17NO2
Molecular Weight159.23 g/mol
Exact Mass159.13
IUPAC Name2,3-dimethyl-4-(methylamino)pentanoic acid
SMILESCNC(C)C(C)C(C)C(=O)O
InChIInChI=1S/C8H17NO2/c1-5(7(3)9-4)6(2)8(10)11/h5-7,9H,1-4H3,(H,10,11)
InChIKeyKENMDUGATGTINA-UHFFFAOYSA-N
XLogP0.95
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500159.23
LogP ≤ 50.95
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2,3-dimethyl-4-(methylamino)pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,3-dimethyl-4-(methylamino)pentanoic acid?
The IUPAC name of 2,3-dimethyl-4-(methylamino)pentanoic acid (CID 58391138) is 2,3-dimethyl-4-(methylamino)pentanoic acid.
What is the SMILES notation for 2,3-dimethyl-4-(methylamino)pentanoic acid?
The canonical SMILES for 2,3-dimethyl-4-(methylamino)pentanoic acid is CNC(C)C(C)C(C)C(=O)O.
What is the InChIKey of 2,3-dimethyl-4-(methylamino)pentanoic acid?
The InChIKey is KENMDUGATGTINA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO2/c1-5(7(3)9-4)6(2)8(10)11/h5-7,9H,1-4H3,(H,10,11).
What are the key properties of 2,3-dimethyl-4-(methylamino)pentanoic acid?
2,3-dimethyl-4-(methylamino)pentanoic acid has a molecular weight of 159.23 g/mol, XLogP of 0.95, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethyl-4-(methylamino)pentanoic acid is sourced from PubChem (CID 58391138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).