C52H88O15 — CID 58391593
6-tert-butyl-23-(3,3-dimethylbutanoyl)-12,19-bis(2,2-dimethylpropyl)-10-[(2-methylpropan-2-yl)oxycarbonyl]-5,13,18,26-tetraoxo-25-propan-2-yl-1,4,14,17-tetraoxacyclohexacosane-8,21-dicarboxylic acid (PubChem CID 58391593) has the molecular formula C52H88O15 and a molecular weight of 953.26 g/mol. Its IUPAC name is 6-tert-butyl-23-(3,3-dimethylbutanoyl)-12,19-bis(2,2-dimethylpropyl)-10-[(2-methylpropan-2-yl)oxycarbonyl]-5,13,18,26-tetraoxo-25-propan-2-yl-1,4,14,17-tetraoxacyclohexacosane-8,21-dicarboxylic acid.
| Compound Name | 6-tert-butyl-23-(3,3-dimethylbutanoyl)-12,19-bis(2,2-dimethylpropyl)-10-[(2-methylpropan-2-yl)oxycarbonyl]-5,13,18,26-tetraoxo-25-propan-2-yl-1,4,14,17-tetraoxacyclohexacosane-8,21-dicarboxylic acid |
|---|---|
| PubChem CID | 58391593 |
| Molecular Formula | C52H88O15 |
| Molecular Weight | 953.26 g/mol |
| Exact Mass | 952.61 |
| IUPAC Name | 6-tert-butyl-23-(3,3-dimethylbutanoyl)-12,19-bis(2,2-dimethylpropyl)-10-[(2-methylpropan-2-yl)oxycarbonyl]-5,13,18,26-tetraoxo-25-propan-2-yl-1,4,14,17-tetraoxacyclohexacosane-8,21-dicarboxylic acid |
| SMILES | CC(C)C1CC(C(=O)CC(C)(C)C)CC(C(=O)O)CC(CC(C)(C)C)C(=O)OCCOC(=O)C(CC(C)(C)C)CC(C(=O)OC(C)(C)C)CC(C(=O)O)CC(C(C)(C)C)C(=O)OCCOC1=O |
| InChI | InChI=1S/C52H88O15/c1-31(2)38-26-32(40(53)30-50(9,10)11)22-33(41(54)55)24-36(28-48(3,4)5)43(58)63-18-19-64-44(59)37(29-49(6,7)8)25-35(45(60)67-52(15,16)17)23-34(42(56)57)27-39(51(12,13)14)47(62)66-21-20-65-46(38)61/h31-39H,18-30H2,1-17H3,(H,54,55)(H,56,57) |
| InChIKey | WQAIALFZKBNBEA-UHFFFAOYSA-N |
| XLogP | 9.53 |
| TPSA | 223.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 67 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 953.26 |
| LogP ≤ 5 | 9.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|