C45H41N3O4 — CID 58391718
4-[[1,3-bis(4-methoxyphenyl)-5,6-dimethylisoindol-2-yl]iminomethyl]-N,N-bis(4-methoxyphenyl)aniline (PubChem CID 58391718) has the molecular formula C45H41N3O4 and a molecular weight of 687.84 g/mol. Its IUPAC name is 4-[[1,3-bis(4-methoxyphenyl)-5,6-dimethylisoindol-2-yl]iminomethyl]-N,N-bis(4-methoxyphenyl)aniline.
| Compound Name | 4-[[1,3-bis(4-methoxyphenyl)-5,6-dimethylisoindol-2-yl]iminomethyl]-N,N-bis(4-methoxyphenyl)aniline |
|---|---|
| PubChem CID | 58391718 |
| Molecular Formula | C45H41N3O4 |
| Molecular Weight | 687.84 g/mol |
| Exact Mass | 687.31 |
| IUPAC Name | 4-[[1,3-bis(4-methoxyphenyl)-5,6-dimethylisoindol-2-yl]iminomethyl]-N,N-bis(4-methoxyphenyl)aniline |
| SMILES | COc1ccc(-c2c3cc(C)c(C)cc3c(-c3ccc(OC)cc3)n2N=Cc2ccc(N(c3ccc(OC)cc3)c3ccc(OC)cc3)cc2)cc1 |
| InChI | InChI=1S/C45H41N3O4/c1-30-27-42-43(28-31(30)2)45(34-11-21-39(50-4)22-12-34)48(44(42)33-9-19-38(49-3)20-10-33)46-29-32-7-13-35(14-8-32)47(36-15-23-40(51-5)24-16-36)37-17-25-41(52-6)26-18-37/h7-29H,1-6H3 |
| InChIKey | LWZKDILMZRYOGR-UHFFFAOYSA-N |
| XLogP | 10.98 |
| TPSA | 57.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.84 |
| LogP ≤ 5 | 10.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|