C43H37N3O4 — CID 58391731
6-(5,6-dimethyl-1,3-diphenylisoindol-2-yl)-13-heptan-2-yl-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone (PubChem CID 58391731) has the molecular formula C43H37N3O4 and a molecular weight of 659.79 g/mol. Its IUPAC name is 6-(5,6-dimethyl-1,3-diphenylisoindol-2-yl)-13-heptan-2-yl-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone.
| Compound Name | 6-(5,6-dimethyl-1,3-diphenylisoindol-2-yl)-13-heptan-2-yl-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone |
|---|---|
| PubChem CID | 58391731 |
| Molecular Formula | C43H37N3O4 |
| Molecular Weight | 659.79 g/mol |
| Exact Mass | 659.28 |
| IUPAC Name | 6-(5,6-dimethyl-1,3-diphenylisoindol-2-yl)-13-heptan-2-yl-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone |
| SMILES | CCCCCC(C)N1C(=O)c2ccc3c4c(ccc(c24)C1=O)C(=O)N(n1c(-c2ccccc2)c2cc(C)c(C)cc2c1-c1ccccc1)C3=O |
| InChI | InChI=1S/C43H37N3O4/c1-5-6-9-14-27(4)44-40(47)30-19-21-32-37-33(22-20-31(36(30)37)41(44)48)43(50)46(42(32)49)45-38(28-15-10-7-11-16-28)34-23-25(2)26(3)24-35(34)39(45)29-17-12-8-13-18-29/h7-8,10-13,15-24,27H,5-6,9,14H2,1-4H3 |
| InChIKey | GQYRFYSYHWLLHV-UHFFFAOYSA-N |
| XLogP | 9.24 |
| TPSA | 79.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.79 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|