About 2-[3-hydroxy-6-oxo-4,5-bis[(quinolin-8-ylamino)methyl]xanthen-9-yl]benzoic acid
2-[3-hydroxy-6-oxo-4,5-bis[(quinolin-8-ylamino)methyl]xanthen-9-yl]benzoic acid (PubChem CID 58391945) has the molecular formula C40H28N4O5
and a molecular weight of 644.69 g/mol. Its IUPAC name is 2-[3-hydroxy-6-oxo-4,5-bis[(quinolin-8-ylamino)methyl]xanthen-9-yl]benzoic acid.
Molecular Properties
| Compound Name | 2-[3-hydroxy-6-oxo-4,5-bis[(quinolin-8-ylamino)methyl]xanthen-9-yl]benzoic acid |
| PubChem CID | 58391945 |
| Molecular Formula | C40H28N4O5 |
| Molecular Weight | 644.69 g/mol |
| Exact Mass | 644.21 |
| IUPAC Name | 2-[3-hydroxy-6-oxo-4,5-bis[(quinolin-8-ylamino)methyl]xanthen-9-yl]benzoic acid |
| SMILES | O=C(O)c1ccccc1-c1c2ccc(=O)c(CNc3cccc4cccnc34)c-2oc2c(CNc3cccc4cccnc34)c(O)ccc12 |
| InChI | InChI=1S/C40H28N4O5/c45-33-17-15-27-35(25-11-1-2-12-26(25)40(47)48)28-16-18-34(46)30(22-44-32-14-4-8-24-10-6-20-42-37(24)32)39(28)49-38(27)29(33)21-43-31-13-3-7-23-9-5-19-41-36(23)31/h1-20,43-45H,21-22H2,(H,47,48) |
| InChIKey | RHKWQKIEIMXTEV-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 137.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 644.69 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-hydroxy-6-oxo-4,5-bis[(quinolin-8-ylamino)methyl]xanthen-9-yl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-hydroxy-6-oxo-4,5-bis[(quinolin-8-ylamino)methyl]xanthen-9-yl]benzoic acid?
The IUPAC name of 2-[3-hydroxy-6-oxo-4,5-bis[(quinolin-8-ylamino)methyl]xanthen-9-yl]benzoic acid (CID 58391945) is 2-[3-hydroxy-6-oxo-4,5-bis[(quinolin-8-ylamino)methyl]xanthen-9-yl]benzoic acid.
What is the SMILES notation for 2-[3-hydroxy-6-oxo-4,5-bis[(quinolin-8-ylamino)methyl]xanthen-9-yl]benzoic acid?
The canonical SMILES for 2-[3-hydroxy-6-oxo-4,5-bis[(quinolin-8-ylamino)methyl]xanthen-9-yl]benzoic acid is O=C(O)c1ccccc1-c1c2ccc(=O)c(CNc3cccc4cccnc34)c-2oc2c(CNc3cccc4cccnc34)c(O)ccc12.
What is the InChIKey of 2-[3-hydroxy-6-oxo-4,5-bis[(quinolin-8-ylamino)methyl]xanthen-9-yl]benzoic acid?
The InChIKey is RHKWQKIEIMXTEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C40H28N4O5/c45-33-17-15-27-35(25-11-1-2-12-26(25)40(47)48)28-16-18-34(46)30(22-44-32-14-4-8-24-10-6-20-42-37(24)32)39(28)49-38(27)29(33)21-43-31-13-3-7-23-9-5-19-41-36(23)31/h1-20,43-45H,21-22H2,(H,47,48).
What are the key properties of 2-[3-hydroxy-6-oxo-4,5-bis[(quinolin-8-ylamino)methyl]xanthen-9-yl]benzoic acid?
2-[3-hydroxy-6-oxo-4,5-bis[(quinolin-8-ylamino)methyl]xanthen-9-yl]benzoic acid has a molecular weight of 644.69 g/mol, XLogP of 8.29, 8 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-hydroxy-6-oxo-4,5-bis[(quinolin-8-ylamino)methyl]xanthen-9-yl]benzoic acid is sourced from PubChem (CID 58391945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).