C6H10O6 — CID 58392006
cis-(2S,5R)-2,3,4,5,6-pentahydroxycyclohexan-1-one (PubChem CID 58392006) has the molecular formula C6H10O6 and a molecular weight of 178.14 g/mol. Its IUPAC name is cis-(2S,5R)-2,3,4,5,6-pentahydroxycyclohexan-1-one.
| Compound Name | cis-(2S,5R)-2,3,4,5,6-pentahydroxycyclohexan-1-one |
|---|---|
| PubChem CID | 58392006 |
| Molecular Formula | C6H10O6 |
| Molecular Weight | 178.14 g/mol |
| Exact Mass | 178.05 |
| IUPAC Name | cis-(2S,5R)-2,3,4,5,6-pentahydroxycyclohexan-1-one |
| SMILES | O=C1C(O)[C@H](O)C(O)C(O)[C@@H]1O |
| InChI | InChI=1S/C6H10O6/c7-1-2(8)4(10)6(12)5(11)3(1)9/h1-5,7-11H/t1?,2-,3?,4?,5+/m1/s1 |
| InChIKey | VYEGBDHSGHXOGT-LAUXEEOCSA-N |
| XLogP | -3.63 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.14 |
| LogP ≤ 5 | -3.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |